View source for Chemistry:Tetronal

{{Short description|Chemical compound}}
{{Drugbox
| verifiedrevid = 451222566
| IUPAC_name = 3,3-bis(ethylsulfonyl)pentane
| image = Tetronal structure.svg
| width = 250

<!--Clinical data-->
| tradename =  
| legal_US = Schedule III

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 2217-59-6
| PubChem = 75197
| UNII_Ref = {{fdacite|correct|FDA}}	
| UNII = 5XG2X0OW34
| ChemSpiderID      = 67743

<!--Chemical data-->
| C=9 | H=20 | O=4 | S=2 
| smiles = CCC(CC)(S(=O)(=O)CC)S(=O)(=O)CC
| StdInChI          = 1S/C9H20O4S2/c1-5-9(6-2,14(10,11)7-3)15(12,13)8-4/h5-8H2,1-4H3
| StdInChIKey       = VTZYVPLHCQBWSP-UHFFFAOYSA-N
}}

'''Tetronal''' is a sedative-hypnotic<ref>{{cite book | date = 1907 | chapter-url = https://archive.org/stream/cu31924003469677#page/n453/mode/2up | chapter = Tetronal | title = Merck's 1907 Index | location = New York | publisher = Merck & Co. | page = 436 }}</ref> and anesthetic drug with [[Biology:GABAergic|GABAergic]] [[Chemistry:Drug action|action]]s{{Citation needed|date=November 2010}}. It is not as effective as trional.<ref>{{cite book | vauthors = Coblentz V | date = 1908 | url = https://books.google.com/books?id=L3PtAAAAMAAJ&pg=PA123 | title = The Newer Remedies | location = Boston | publisher = Apothecary Publishing Co. | page = 123 }}</ref>

==History==
Tetronal was introduced by Eugen Baumann and Alfred Kast in 1888.<ref>{{cite book | vauthors = Drinkwater H | date = 1924 | url = https://archive.org/stream/fiftyyearsofmedi00drin#page/40/mode/2up | title = Fifty years of medical progress, 1873-1922 | location = New York | publisher = The Macmillan Company | page = 40 }}</ref>

==See also==
* Sulfonal
* [[Chemistry:Trional|Trional]]

==References==
{{Reflist}}

{{Hypnotics}}
{{General anesthetics}}
{{GABAAR PAMs}}

[[Category:Hypnotics]]
[[Category:Sulfones]]
[[Category:GABAA receptor positive allosteric modulators]]



{{Sourceattribution|Tetronal}}