View source for Chemistry:O-1656

{{Short description|Chemical compound}}
{{Drugbox
| IUPAC_name = 2-cycloheptyl-5-(2-methyloctan-2-yl)benzene-1,3-diol
| image = O-1656_structure.png
| width = 280

<!--Clinical data-->
| tradename =  
| pregnancy_category =  
| legal_status = 
| routes_of_administration =  

<!--Pharmacokinetic data-->
| bioavailability =  
| metabolism =  
| elimination_half-life =  
| excretion =  

<!--Identifiers-->
| CAS_number = 468083-75-2 
| ATC_prefix = none
| ATC_suffix =  
| PubChem = 58803980
| ChemSpiderID      = 

<!--Chemical data-->
| C=22 | H=36 | O=2 
| smiles = CCCCCCC(C)(C)C1=CC(=C(C(=C1)O)C2CCCCCC2)O
| StdInChI          = 1S/C22H36O2/c1-4-5-6-11-14-22(2,3)18-15-19(23)21(20(24)16-18)17-12-9-7-8-10-13-17/h15-17,23-24H,4-14H2,1-3H3
| StdInChIKey       = AECZEBWFCJESSN-UHFFFAOYSA-N
}}

'''O-1656''' is a [[Chemistry:Cannabinoid|cannabinoid]] agonist which was invented by Billy R Martin and Raj K Razdan at Organix Inc in 2002. It is moderately selective for the [[Biology:Cannabinoid receptor 2|CB<sub>2</sub>]] receptor with a [[Biology:Cannabinoid receptor 1|CB<sub>1</sub>]] receptor affinity of 18&nbsp;nM and a CB<sub>2</sub> receptor affinity of 2&nbsp;nM.<ref>{{cite patent |country= WO |number= 03091189 |status= application |title= Cannabinoids |pubdate= 6 November 2003 |gdate= |fdate=  20 June 2002 |pridate= 25 June 2002 |inventor= Martin BR, Razdan RK |assign1= University of Virginia }}</ref><ref name="Wiley_2002">{{cite journal | vauthors = Wiley JL, Beletskaya ID, Ng EW, Dai Z, Crocker PJ, Mahadevan A, Razdan RK, Martin BR | title = Resorcinol derivatives: a novel template for the development of cannabinoid CB(1)/CB(2) and CB(2)-selective agonists | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 301 | issue = 2 | pages = 679–89 | date = May 2002 | pmid = 11961073 | doi = 10.1124/jpet.301.2.679 | s2cid = 12741224 }}</ref><ref name="Adam_2006">{{cite journal | vauthors = Adam J, Cowley PM, Kiyoi T, Morrison AJ, Mort CJ | title = Recent progress in cannabinoid research | journal = Progress in Medicinal Chemistry | volume = 44 | issue = | pages = 207–329 | date = 2006 | pmid = 16697899 | doi = 10.1016/S0079-6468(05)44406-9 | isbn = 9780444517371 }}</ref> Since it has a [[Chemistry:Cycloheptane|cycloheptyl]] ring attached to the [[Chemistry:Phenol|phenol]] core, it falls outside the definition of a [[Chemistry:Structural scheduling of synthetic cannabinoids|"cyclohexylphenol derivative"]], but may still be controlled by generic legislation in some jurisdictions.

==See also==
* [[Chemistry:Abeo-HHC acetate|Abeo-HHC acetate]]
* [[Chemistry:CBD-DMH|CBD-DMH]]
* [[Chemistry:CP 55,940|CP 55,940]]
* [[Chemistry:Cannabidiol|Cannabidiol]]
* [[Chemistry:Cannabicyclohexanol|Cannabicyclohexanol]]
* [[Chemistry:Cycloheptyl CP 55,940|Cycloheptyl CP 55,940]]
* [[Chemistry:O-1871|O-1871]]

==References==
{{reflist}}

{{Cannabinoids}}
[[Category:Cannabinoids]]

{{Sourceattribution|O-1656}}