View source for Chemistry:LASSBio-881

{{Short description|Chemical compound}}
{{Drugbox
| IUPAC_name =  
| image = LASSBio-881_structure.png
| width = 240

<!--Clinical data-->
| pregnancy_category =  
| legal_status =

<!--Identifiers-->
| CAS_number = 
| ATC_prefix =  
| ATC_suffix =  
| PubChem = 16721055
| ChemSpiderID      = 23293401
| ChEMBL = 234619

<!--Chemical data-->
| C=23|H=27|N=3|O=6
| smiles = Oc1c(C(C)(C)C)cc(cc1C(C)(C)C)\C=N\NC(=O)c2cc3OCOc3cc2[N](=O)=O
| StdInChI          = 1S/C23H27N3O6/c1-22(2,3)15-7-13(8-16(20(15)27)23(4,5)6)11-24-25-21(28)14-9-18-19(32-12-31-18)10-17(14)26(29)30/h7-11,27H,12H2,1-6H3,(H,25,28)/b24-11+
| StdInChIKey       = XEYZVZBNMMRXSN-BHGWPJFGSA-N
}}

'''LASSBio-881''' is a drug which acts as both a non-selective [[Chemistry:Partial agonist|partial agonist]] of the [[Biology:Cannabinoid receptor 1|CB<sub>1</sub>]] and [[Biology:Cannabinoid receptor 2|CB<sub>2</sub>]] [[Biology:Cannabinoid receptor|cannabinoid receptor]]s, and also as an antagonist of the [[Biology:TRPV1|TRPV1]] receptor, as well as having [[Biology:Antioxidant|antioxidant]] effects. It has potent [[Chemistry:Anti-inflammatory|anti-inflammatory]] and anti-hyperalgesic effects in animal studies.<ref>{{cite journal | vauthors = Duarte CD, Tributino JL, Lacerda DI, Martins MV, Alexandre-Moreira MS, Dutra F, Bechara EJ, De-Paula FS, Goulart MO, Ferreira J, Calixto JB, Nunes MP, Bertho AL, Miranda AL, Barreiro EJ, Fraga CA | display-authors = 6 | title = Synthesis, pharmacological evaluation and electrochemical studies of novel 6-nitro-3,4-methylenedioxyphenyl-N-acylhydrazone derivatives: Discovery of LASSBio-881, a new ligand of cannabinoid receptors | journal = Bioorganic & Medicinal Chemistry | volume = 15 | issue = 6 | pages = 2421–33 | date = March 2007 | pmid = 17275312 | doi = 10.1016/j.bmc.2007.01.013 }}</ref><ref>{{cite journal | vauthors = Tributino JL, Santos ML, Mesquita CM, Lima CK, Silva LL, Maia RC, Duarte CD, Barreiro EJ, Fraga CA, Castro NG, Miranda AL, Guimaraes MZ | display-authors = 6 | title = LASSBio-881: an N-acylhydrazone transient receptor potential vanilloid subfamily type 1 antagonist orally effective against the hypernociception induced by capsaicin or partial sciatic ligation | journal = British Journal of Pharmacology | volume = 159 | issue = 8 | pages = 1716–23 | date = April 2010 | pmid = 20401963 | doi = 10.1111/j.1476-5381.2010.00672.x | pmc = 2925494 }}</ref>

*LASSBio-945 has an identical structure ''sans'' the nitro [[Chemistry:Functional group|FG]].
== References ==
{{reflist}}


{{Cannabinoids}}

[[Category:Cannabinoids]]

{{Sourceattribution|LASSBio-881}}