View source for Chemistry:CRL-40,941

{{Short description|Wakefulness promoting drug}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 451554065
| IUPAC_name = 2-{[Bis(4-fluorophenyl)methyl]sulfinyl}-''N''-hydroxyacetamide
| synonyms = Fluorafinil, Fladrafinil
| image = CRL-40,941.svg
| tradename =  
| pregnancy_category =  
| legal_US_comment = Not approved
| routes_of_administration = Oral
| bioavailability =  
| metabolism =  
| elimination_half-life =  
| excretion = 

<!--Identifiers-->
| CAS_number_Ref = {{cascite|changed|??}}
| CAS_number =90212-80-9
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 5RT6X0M01F
| ATC_prefix = none
| ATC_suffix =  
| PubChem =  13316557
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 29785194
| C=15 | H=13 | F=2 | N=1 | O=3 | S=1
| smiles = C1=CC(=CC=C1C(C2=CC=C(C=C2)F)S(=O)CC(=O)NO)F
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C15H13F2NO3S/c16-12-5-1-10(2-6-12)15(22(21)9-14(19)18-20)11-3-7-13(17)8-4-11/h1-8,15,20H,9H2,(H,18,19)
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = VKGUUSVYPXTWMA-UHFFFAOYSA-N
}}

'''CRL-40,941''' (also known as '''fladrafinil ''' and '''fluorafinil''') is a [[Chemistry:Eugeroic|eugeroic]] closely related to [[Chemistry:Adrafinil|adrafinil]] and [[Chemistry:Modafinil|modafinil]]. It is the bis(''p''-fluoro) ring-substituted derivative of adrafinil. CRL-40,941 was found to produce antiaggressive effects in animals, which adrafinil does not produce; it purportedly 3–4 times more potent than adrafinil.<ref name="patent4489095">{{Cite patent |country=US |number=4489095 |title=Halogenobenzhydrylsulfinylacetohydroxamic acids |pubdate=1984-12-18|inventor = Lafon L |assign1=Laboratoire L. Lafon}}</ref>{{Failed verification|date=December 2023}}

==See also==
* [[Chemistry:Adrafinil|Adrafinil]]
* [[Chemistry:Armodafinil|Armodafinil]]
* [[Chemistry:CRL-40,940|CRL-40,940]]
* [[Chemistry:Fluorenol|Fluorenol]]
* [[Chemistry:CE-123|CE-123]]

==References==
{{Reflist}}

{{Stimulants}}

[[Category:Abandoned drugs]]
[[Category:Benzene derivatives]]
[[Category:Designer drugs]]
[[Category:Drugs with unknown mechanisms of action]]
[[Category:Fluoroarenes]]
[[Category:Hydroxamic acids]]
[[Category:Prodrugs]]
[[Category:Stimulants]]
[[Category:Sulfoxides]]


{{Sourceattribution|CRL-40,941}}