View source for Chemistry:AM-2232

{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 451605653
| IUPAC_name = 5-(3-(1-Naphthoyl)-1''H''-indol-1-yl)pentanenitrile
| image = AM-2232_structure.png
| width = 150

<!--Clinical data-->
| tradename =  
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B            / C / D / X -->
| pregnancy_category =  
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = Schedule II
| legal_DE = Anlage II
| legal_UK = Class B
| legal_US = Schedule I
| legal_NZ = Temporary Class 
| legal_status =
| routes_of_administration =  

<!--Pharmacokinetic data-->
| bioavailability =  
| protein_bound =  
| metabolism =  
| elimination_half-life =  
| excretion =  

<!--Identifiers-->
| CAS_number_Ref = {{cascite|changed|??}}
| CAS_number = 335161-19-8 
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 40KCH8YIKP
| ATC_prefix =  
| ATC_suffix =  
| PubChem =  
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =  
|  ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 26633898
|  smiles = c1ccc2c(c1)cccc2C(=O)c3cn(c4c3cccc4)CCCCC#N
|  StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C24H20N2O/c25-15-6-1-7-16-26-17-22(20-12-4-5-14-23(20)26)24(27)21-13-8-10-18-9-2-3-11-19(18)21/h2-5,8-14,17H,1,6-7,16H2
|  StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = VWVAIBKHFCUSMD-UHFFFAOYSA-N

<!--Chemical data-->
| C=24 | H=20 | N=2 | O=1 
}}

'''AM-2232''' ('''1-(4-cyanobutyl)-3-(naphthalen-1-oyl)indole''') is a drug that acts as a potent but unselective [[Biology:Agonist|agonist]] for the [[Biology:Cannabinoid receptor|cannabinoid receptor]]s, with a [[Chemistry:Dissociation constant|''K''<sub>i</sub>]] of 0.28&nbsp;nM at [[Biology:Cannabinoid receptor 1|CB<sub>1</sub>]] and 1.48&nbsp;nM at CB<sub>2</sub>.<ref name="US 7241799">{{Ref patent2 | country = US | number = 7241799 | status = granted | title = Cannabimimetic indole derivatives | pubdate = 2004-11-05 | gdate = 2007-07-10 | pridate= 2004-11-05 | inventor = Makriyannis A, Deng H | assign1= }}</ref>

In the United States, all CB<sub>1</sub> receptor agonists of the 3-(1-naphthoyl)indole class such as AM-2232 are Schedule I Controlled Substances.<ref>{{UnitedStatesCode2|21|812|Schedules of controlled substances}}</ref>

==See also==
* [[Chemistry:AM-694|AM-694]]
* [[Chemistry:AM-1235|AM-1235]]
* [[Chemistry:AM-2233|AM-2233]]
* [[Chemistry:FUBIMINA|FUBIMINA]]
* [[Chemistry:JWH-018|JWH-018]]
* List of AM cannabinoids
* [[Chemistry:List of JWH cannabinoids|List of JWH cannabinoids]]
* [[Chemistry:O-774|O-774]]
* [[Chemistry:O-1057|O-1057]]
* [[Chemistry:O-1812|O-1812]]
* [[Chemistry:THJ-2201|THJ-2201]]

==References==
<references/>

{{Cannabinoids}}

[[Category:Naphthoylindoles]]
[[Category:Nitriles]]
[[Category:Designer drugs]]



{{Sourceattribution|AM-2232}}