View source for Chemistry:5F-EDMB-PINACA

{{Short description|Chemical compound}}
{{Infobox drug
| drug_name         =
| INN               =
| type              =<!-- empty -->
| IUPAC_name        = Ethyl (''S'')-2-(1-(5-fluoropentyl)-1''H''-indazole-3-carboxamido)-3,3-dimethylbutanoate
| image             = 5F-EDMB-PINACA.svg
| width             = 150 
| caption           =
<!-- Clinical data -->
| pronounce         =
| tradename         = 
| Drugs.com         = 
| MedlinePlus       = 
| pregnancy_AU      = <!-- A/B1/B2/B3/C/D/X -->
| pregnancy_AU_comment = 
| pregnancy_US      = <!-- A/B/C/D/X/N -->
| pregnancy_category= 
| routes_of_administration = 
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_AU_comment =
| legal_BR =  <!-- OTC, A1, A2, A3, B1, B2, C1, C2, C3, C4, C5, D1, D2, E, F-->
| legal_BR_comment =
| legal_CA = Schedule II
| legal_DE = NpSG
| legal_NZ = <!-- Class A, B, C -->
| legal_UK = Class B
| legal_US = Schedule I
| legal_UN = <!-- N I, II, III, IV / P I, II, III, IV-->
| legal_status      = <!-- Free text -->
<!-- Pharmacokinetic data -->
| bioavailability   = 
| protein_bound     = 
| metabolism        = 
| metabolites       =
| onset             = 
| elimination_half-life = 
| duration_of_action =
| excretion         = 
<!-- Identifiers -->
| CAS_number        = 1715016-75-3
| CAS_number_Ref = {{cascite|correct|CAS}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = UN52BPP7RB
| class             = 
| ATCvet            = 
| ATC_prefix        = <!-- 'none' if uncategorised -->
| ATC_suffix        = 
| PubChem           = 137700114
| ChemSpiderID = 68004011
| DrugBank          = 
| synonyms          = 5-Fluoro EDMB-PINACA
<!-- Chemical and physical data -->
| C=21|H=30|F=1|N=3|O=3
| smiles = O=C(N[C@H](C(OCC)=O)C(C)(C)C)C1=NN(CCCCCF)C2=C1C=CC=C2
| StdInChI=1S/C21H30FN3O3/c1-5-28-20(27)18(21(2,3)4)23-19(26)17-15-11-7-8-12-16(15)25(24-17)14-10-6-9-13-22/h7-8,11-12,18H,5-6,9-10,13-14H2,1-4H3,(H,23,26)/t18-/m1/s1
| StdInChIKey=VDEACSPMBSUVRD-GOSISDBHSA-N
}}

'''5F-EDMB-PINACA''' is a [[Chemistry:Designer drug|designer drug]] and synthetic cannabinoid.<ref>{{Cite journal | doi = 10.1002/dta.2160 | pmid = 28063270 | title = Identification and analytical characterization of six synthetic cannabinoids NNL-3, 5F-NPB-22-7N , 5F-AKB-48-7N , 5F-EDMB-PINACA, EMB-FUBINACA, and EG-018 | journal = Drug Testing and Analysis | volume = 9 | issue = 8 | pages = 1251–1261 | year = 2017 | vauthors = Liu C, Jia W, Hua Z, Qian Z }}</ref><ref>{{cite web | url = https://www.forensicscienceeducation.org/wp-content/uploads/2018/05/5F-EDMB-PINACA_041018_NMSLabs_Report.pdf | title = 5F-EDMB-PINACA | publisher = NMS Labs  }}</ref>  In 2018, it was the fourth-most common synthetic cannabinoid identified in drugs seized by the [[Organization:Drug Enforcement Administration|Drug Enforcement Administration]].<ref>{{cite web | url = https://ndews.umd.edu/sites/ndews.umd.edu/files/Emerging-Threat-Report-2018-Annual.pdf | title = Emerging Threat Report: Annual 2018 | publisher = Special Testing and Research Laboratory, Drug Enforcement Administration | access-date = 2019-08-03 | archive-date = 2019-08-01 | archive-url = https://web.archive.org/web/20190801190403/https://ndews.umd.edu/sites/ndews.umd.edu/files/Emerging-Threat-Report-2018-Annual.pdf | url-status = dead }}</ref>

In the United States, 5F-EDMB-PINACA was temporarily emergency scheduled by the DEA in 2019.<ref name="fedreg-Apr-2019">{{cite web | title = Schedules of Controlled Substances: Temporary Placement of 5F-EDMB-PINACA, 5F-MDMB-PICA, FUB-AKB48, 5F-CUMYL-PINACA, and FUB-144 into Schedule I | url = https://www.federalregister.gov/documents/2019/04/16/2019-07460/schedules-of-controlled-substances-temporary-placement-of-5f-edmb-pinaca-5f-mdmb-pica-fub-akb48 | publisher = Federal Register | date = 2019-04-16 }}</ref> and made a permanent Schedule I Controlled Substance on April 7, 2022.<ref>{{cite journal |title=Schedules of Controlled Substances: Placement of 5F-EDMB-PINACA, 5FMDMB-PICA, FUB-AKB48, 5F-CUMYLPINACA, and FUB-144 in Schedule I  |journal=Federal Register |date=2022-04-07 |volume=87 |issue=67 |url=https://www.govinfo.gov/content/pkg/FR-2022-04-07/pdf/2022-07320.pdf}}</ref>

==References==
{{reflist}}

{{Cannabinoids}}

[[Category:Cannabinoids]]

{{Sourceattribution|5F-EDMB-PINACA}}