View source for Chemistry:2,5-Dimethoxy-4-(2-fluoroethyl)amphetamine

{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 477211525
| ImageFile1 = 2,5-Dimethoxy-4-(2-fluoroethyl)amphetamine.svg
| ImageSize1 = 200px
| PIN = 1-[4-(2-Fluoroethyl)-2,5-dimethoxyphenyl]propan-2-amine
|Section1={{Chembox Identifiers
| InChI = 1/C13H20FNO2/c1-9(15)6-11-8-12(16-2)10(4-5-14)7-13(11)17-3/h7-9H,4-6,15H2,1-3H3
| SMILES1 = COc1cc(CC(C)N)c(cc1CCF)OC
| InChIKey = QLENKWFQUHHBKZ-UHFFFAOYAO
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 123685
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C13H20FNO2/c1-9(15)6-11-8-12(16-2)10(4-5-14)7-13(11)17-3/h7-9H,4-6,15H2,1-3H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = QLENKWFQUHHBKZ-UHFFFAOYSA-N
| CASNo_Ref = {{cascite|changed|??}}
| CASNo = 121649-01-2
| UNII = 72UT55MXE3
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID=21106293 
| PubChem = 14201982
| SMILES = C1(=CC(=C(C=C1CC(C)N)OC)CCF)OC
}}
|Section2={{Chembox Properties
| C=13|H=20|N=1|O=2|F=1
| Appearance = 
| Density = 
| MeltingPt = 
| BoilingPt = 
| Solubility = }}
|Section3={{Chembox Hazards
| MainHazards = 
| FlashPt = 
| AutoignitionPt = }}
}}

''' 2,5-Dimethoxy-4-(2-fluoroethyl)amphetamine''' ('''DOEF'''; also known as '''dimethoxyfluoroethylamphetamine''') is a lesser-known [[Chemistry:Psychedelic drug|psychedelic drug]] and member of the [[Chemistry:DOx|DOx class]].<ref>{{cite journal | doi = 10.1016/S0040-4039(00)82391-6| title = Synthesis of 1-&#91;2′,5′-dimethoxy-4′-(β-fluoroethyl)phenyl&#93;-2-aminopropane:studies related to 18F-labeled serotonin receptor ligands| journal = Tetrahedron Letters| volume = 29| issue = 50| pages = 6537–6539| year = 1988| last1 = Gerdes| first1 = John M.| last2 = Mathis| first2 = Chester A.| last3 = Shulgin| first3 = Alexander T.}}</ref><ref>{{cite journal | doi = 10.1002/dta.413| pmid = 22374819| title = Fluorine in psychedelic phenethylamines| journal = Drug Testing and Analysis| volume = 4| issue = 7–8| pages = 577–590| year = 2012| last1 = Trachsel| first1 = Daniel}}</ref> DOEF was first synthesized by Alexander Shulgin. In his book ''[[Chemistry:PiHKAL|PiHKAL]]'', the dosage range is listed as 2–3.5&nbsp;mg, and the duration is listed as 12–16 hours.<ref>[http://www.erowid.org/library/books_online/pihkal/pihkal065.shtml DOEF Entry in ''PiHKAL'']</ref> Very little data exists about the pharmacological properties, metabolism, and toxicity of DOEF.

==See also==
* DOET
* [[Chemistry:DOPF|DOPF]]
* DOTFM

==References==
{{reflist}}

{{Hallucinogens}}

{{DEFAULTSORT:Dimethoxy-4-fluoroethylamphetamine, 2,5-}}
[[Category:Substituted amphetamines]]
[[Category:Fluoroethyl compounds]]



{{Sourceattribution|2,5-Dimethoxy-4-(2-fluoroethyl)amphetamine}}